C11H17F3N2O — CID 166979521
1-propan-2-yl-3-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-3-yl]urea (PubChem CID 166979521) has the molecular formula C11H17F3N2O and a molecular weight of 250.26 g/mol. Its IUPAC name is 1-propan-2-yl-3-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-3-yl]urea.
| Compound Name | 1-propan-2-yl-3-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-3-yl]urea |
|---|---|
| PubChem CID | 166979521 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 1-propan-2-yl-3-[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-3-yl]urea |
| SMILES | C/C=C(\C=C(/C)C(F)(F)F)NC(=O)NC(C)C |
| InChI | InChI=1S/C11H17F3N2O/c1-5-9(6-8(4)11(12,13)14)16-10(17)15-7(2)3/h5-7H,1-4H3,(H2,15,16,17)/b8-6+,9-5+ |
| InChIKey | GXBATNTUQJTJLE-RFSWUZDDSA-N |
| XLogP | 3.11 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|