C23H33N3O9S — CID 166980158
[(E)-1-[4-[[(1R)-1-(4-methoxy-6-oxopyran-2-yl)butyl]carbamoyl]-4,5-dihydro-1,3-thiazol-2-yl]ethylideneamino] 2-[2-(2-methoxyethoxy)ethoxy]acetate (PubChem CID 166980158) has the molecular formula C23H33N3O9S and a molecular weight of 527.60 g/mol. Its IUPAC name is [(E)-1-[4-[[(1R)-1-(4-methoxy-6-oxopyran-2-yl)butyl]carbamoyl]-4,5-dihydro-1,3-thiazol-2-yl]ethylideneamino] 2-[2-(2-methoxyethoxy)ethoxy]acetate.
| Compound Name | [(E)-1-[4-[[(1R)-1-(4-methoxy-6-oxopyran-2-yl)butyl]carbamoyl]-4,5-dihydro-1,3-thiazol-2-yl]ethylideneamino] 2-[2-(2-methoxyethoxy)ethoxy]acetate |
|---|---|
| PubChem CID | 166980158 |
| Molecular Formula | C23H33N3O9S |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | [(E)-1-[4-[[(1R)-1-(4-methoxy-6-oxopyran-2-yl)butyl]carbamoyl]-4,5-dihydro-1,3-thiazol-2-yl]ethylideneamino] 2-[2-(2-methoxyethoxy)ethoxy]acetate |
| SMILES | CCC[C@@H](NC(=O)C1CSC(/C(C)=N/OC(=O)COCCOCCOC)=N1)c1cc(OC)cc(=O)o1 |
| InChI | InChI=1S/C23H33N3O9S/c1-5-6-17(19-11-16(31-4)12-20(27)34-19)24-22(29)18-14-36-23(25-18)15(2)26-35-21(28)13-33-10-9-32-8-7-30-3/h11-12,17-18H,5-10,13-14H2,1-4H3,(H,24,29)/b26-15+/t17-,18?/m1/s1 |
| InChIKey | GSTQEVOBCNCSDE-BURWFVATSA-N |
| XLogP | 1.72 |
| TPSA | 147.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|