C22H24FN3S — CID 166980733
1-cyclopropyl-4-fluoro-2-(4-methylsulfanylphenyl)-6-piperidin-4-ylbenzimidazole (PubChem CID 166980733) has the molecular formula C22H24FN3S and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-cyclopropyl-4-fluoro-2-(4-methylsulfanylphenyl)-6-piperidin-4-ylbenzimidazole.
| Compound Name | 1-cyclopropyl-4-fluoro-2-(4-methylsulfanylphenyl)-6-piperidin-4-ylbenzimidazole |
|---|---|
| PubChem CID | 166980733 |
| Molecular Formula | C22H24FN3S |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-cyclopropyl-4-fluoro-2-(4-methylsulfanylphenyl)-6-piperidin-4-ylbenzimidazole |
| SMILES | CSc1ccc(-c2nc3c(F)cc(C4CCNCC4)cc3n2C2CC2)cc1 |
| InChI | InChI=1S/C22H24FN3S/c1-27-18-6-2-15(3-7-18)22-25-21-19(23)12-16(14-8-10-24-11-9-14)13-20(21)26(22)17-4-5-17/h2-3,6-7,12-14,17,24H,4-5,8-11H2,1H3 |
| InChIKey | LTYWLJFWBTWCTD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |