C15H31N3 — CID 166981033
2-(2-ethyl-4-methylhexyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine (PubChem CID 166981033) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is 2-(2-ethyl-4-methylhexyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine.
| Compound Name | 2-(2-ethyl-4-methylhexyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine |
|---|---|
| PubChem CID | 166981033 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | 2-(2-ethyl-4-methylhexyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-amine |
| SMILES | CCC(C)CC(CC)CN1CC2CN(N)CC2C1 |
| InChI | InChI=1S/C15H31N3/c1-4-12(3)6-13(5-2)7-17-8-14-10-18(16)11-15(14)9-17/h12-15H,4-11,16H2,1-3H3 |
| InChIKey | SPVNVPCODCLZES-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|