C16H22O — CID 166981321
2-ethyl-5-phenoxy-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 166981321) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-ethyl-5-phenoxy-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | 2-ethyl-5-phenoxy-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 166981321 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 2-ethyl-5-phenoxy-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | CCC1CC2CC(Oc3ccccc3)CC2C1 |
| InChI | InChI=1S/C16H22O/c1-2-12-8-13-10-16(11-14(13)9-12)17-15-6-4-3-5-7-15/h3-7,12-14,16H,2,8-11H2,1H3 |
| InChIKey | FSPYVSKIMCRARB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |