C25H24Cl2N2O2 — CID 166981390
2-chloro-4-[3-[(E)-2-(2-chloro-5-oxo-6,7-dihydrocyclopenta[b]pyridin-6-yl)ethenyl]-2,2,4,4-tetramethylcyclobutyl]oxybenzonitrile (PubChem CID 166981390) has the molecular formula C25H24Cl2N2O2 and a molecular weight of 455.39 g/mol. Its IUPAC name is 2-chloro-4-[3-[(E)-2-(2-chloro-5-oxo-6,7-dihydrocyclopenta[b]pyridin-6-yl)ethenyl]-2,2,4,4-tetramethylcyclobutyl]oxybenzonitrile.
| Compound Name | 2-chloro-4-[3-[(E)-2-(2-chloro-5-oxo-6,7-dihydrocyclopenta[b]pyridin-6-yl)ethenyl]-2,2,4,4-tetramethylcyclobutyl]oxybenzonitrile |
|---|---|
| PubChem CID | 166981390 |
| Molecular Formula | C25H24Cl2N2O2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-chloro-4-[3-[(E)-2-(2-chloro-5-oxo-6,7-dihydrocyclopenta[b]pyridin-6-yl)ethenyl]-2,2,4,4-tetramethylcyclobutyl]oxybenzonitrile |
| SMILES | CC1(C)C(/C=C/C2Cc3nc(Cl)ccc3C2=O)C(C)(C)C1Oc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C25H24Cl2N2O2/c1-24(2)20(9-6-14-11-19-17(22(14)30)8-10-21(27)29-19)25(3,4)23(24)31-16-7-5-15(13-28)18(26)12-16/h5-10,12,14,20,23H,11H2,1-4H3/b9-6+ |
| InChIKey | JYCZDVCOKVZQHA-RMKNXTFCSA-N |
| XLogP | 6.30 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|