About 5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one
5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one (PubChem CID 166981881) has the molecular formula C7H6BrFN2O
and a molecular weight of 233.04 g/mol. Its IUPAC name is 5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one |
| PubChem CID | 166981881 |
| Molecular Formula | C7H6BrFN2O |
| Molecular Weight | 233.04 g/mol |
| Exact Mass | 231.96 |
| IUPAC Name | 5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one |
| SMILES | O=c1c(Br)cncn1[C@@H]1C[C@@H]1F |
| InChI | InChI=1S/C7H6BrFN2O/c8-4-2-10-3-11(7(4)12)6-1-5(6)9/h2-3,5-6H,1H2/t5-,6+/m0/s1 |
| InChIKey | PKFMGXWAHSBQPH-NTSWFWBYSA-N |
| XLogP | 1.29 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.04 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one?
The IUPAC name of 5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one (CID 166981881) is 5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one.
What is the SMILES notation for 5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one?
The canonical SMILES for 5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one is O=c1c(Br)cncn1[C@@H]1C[C@@H]1F.
What is the InChIKey of 5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one?
The InChIKey is PKFMGXWAHSBQPH-NTSWFWBYSA-N. The full InChI is InChI=1S/C7H6BrFN2O/c8-4-2-10-3-11(7(4)12)6-1-5(6)9/h2-3,5-6H,1H2/t5-,6+/m0/s1.
What are the key properties of 5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one?
5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one has a molecular weight of 233.04 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-[(1R,2S)-2-fluorocyclopropyl]pyrimidin-4-one is sourced from PubChem (CID 166981881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).