C16H26N2O — CID 166982209
1-[(3Z)-hexa-1,3-dien-2-yl]-1-(oxan-2-yl)-2-[(2Z)-penta-2,4-dienyl]hydrazine (PubChem CID 166982209) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 1-[(3Z)-hexa-1,3-dien-2-yl]-1-(oxan-2-yl)-2-[(2Z)-penta-2,4-dienyl]hydrazine.
| Compound Name | 1-[(3Z)-hexa-1,3-dien-2-yl]-1-(oxan-2-yl)-2-[(2Z)-penta-2,4-dienyl]hydrazine |
|---|---|
| PubChem CID | 166982209 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 1-[(3Z)-hexa-1,3-dien-2-yl]-1-(oxan-2-yl)-2-[(2Z)-penta-2,4-dienyl]hydrazine |
| SMILES | C=C/C=C\CNN(C(=C)/C=C\CC)C1CCCCO1 |
| InChI | InChI=1S/C16H26N2O/c1-4-6-9-13-17-18(15(3)11-7-5-2)16-12-8-10-14-19-16/h4,6-7,9,11,16-17H,1,3,5,8,10,12-14H2,2H3/b9-6-,11-7- |
| InChIKey | KOFBYYPXTIIFGY-TVBMFEEWSA-N |
| XLogP | 3.54 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|