C21H27N7O2S — CID 166983039
5-[3-methoxy-5-(methylaminosulfanyl)phenyl]-3-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]oxypyrazin-2-amine (PubChem CID 166983039) has the molecular formula C21H27N7O2S and a molecular weight of 441.56 g/mol. Its IUPAC name is 5-[3-methoxy-5-(methylaminosulfanyl)phenyl]-3-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]oxypyrazin-2-amine.
| Compound Name | 5-[3-methoxy-5-(methylaminosulfanyl)phenyl]-3-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]oxypyrazin-2-amine |
|---|---|
| PubChem CID | 166983039 |
| Molecular Formula | C21H27N7O2S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 5-[3-methoxy-5-(methylaminosulfanyl)phenyl]-3-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]oxypyrazin-2-amine |
| SMILES | CNSc1cc(OC)cc(-c2cnc(N)c(Oc3cnn(C4CCN(C)CC4)c3)n2)c1 |
| InChI | InChI=1S/C21H27N7O2S/c1-23-31-18-9-14(8-16(10-18)29-3)19-12-24-20(22)21(26-19)30-17-11-25-28(13-17)15-4-6-27(2)7-5-15/h8-13,15,23H,4-7H2,1-3H3,(H2,22,24) |
| InChIKey | YQJBPSKZYZMWCE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|