About trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine
trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine (PubChem CID 166983515) has the molecular formula C11H25N3
and a molecular weight of 199.34 g/mol. Its IUPAC name is trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine.
Molecular Properties
| Compound Name | trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine |
| PubChem CID | 166983515 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine |
| SMILES | CCN(CC)C[C@]1(N)CCC[C@@]1(C)N |
| InChI | InChI=1S/C11H25N3/c1-4-14(5-2)9-11(13)8-6-7-10(11,3)12/h4-9,12-13H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | SHWMAMQVLUMPAD-GHMZBOCLSA-N |
| XLogP | 0.93 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine?
The IUPAC name of trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine (CID 166983515) is trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine.
What is the SMILES notation for trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine?
The canonical SMILES for trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine is CCN(CC)C[C@]1(N)CCC[C@@]1(C)N.
What is the InChIKey of trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine?
The InChIKey is SHWMAMQVLUMPAD-GHMZBOCLSA-N. The full InChI is InChI=1S/C11H25N3/c1-4-14(5-2)9-11(13)8-6-7-10(11,3)12/h4-9,12-13H2,1-3H3/t10-,11-/m1/s1.
What are the key properties of trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine?
trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine has a molecular weight of 199.34 g/mol, XLogP of 0.93, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-1-(diethylaminomethyl)-2-methylcyclopentane-1,2-diamine is sourced from PubChem (CID 166983515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).