About N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide
N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide (PubChem CID 166983517) has the molecular formula C19H22N4O3
and a molecular weight of 354.41 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide.
Molecular Properties
| Compound Name | N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide |
| PubChem CID | 166983517 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide |
| SMILES | CNc1cnc(Nc2ccc3c(c2)OCO3)cc1N(C=O)C1CCCC1 |
| InChI | InChI=1S/C19H22N4O3/c1-20-15-10-21-19(9-16(15)23(11-24)14-4-2-3-5-14)22-13-6-7-17-18(8-13)26-12-25-17/h6-11,14,20H,2-5,12H2,1H3,(H,21,22) |
| InChIKey | IHOZDDCYUGNOHN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide?
The IUPAC name of N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide (CID 166983517) is N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide.
What is the SMILES notation for N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide?
The canonical SMILES for N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide is CNc1cnc(Nc2ccc3c(c2)OCO3)cc1N(C=O)C1CCCC1.
What is the InChIKey of N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide?
The InChIKey is IHOZDDCYUGNOHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O3/c1-20-15-10-21-19(9-16(15)23(11-24)14-4-2-3-5-14)22-13-6-7-17-18(8-13)26-12-25-17/h6-11,14,20H,2-5,12H2,1H3,(H,21,22).
What are the key properties of N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide?
N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide has a molecular weight of 354.41 g/mol, XLogP of 3.50, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,3-benzodioxol-5-ylamino)-5-(methylamino)-4-pyridinyl]-N-cyclopentylformamide is sourced from PubChem (CID 166983517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).