C15H23NO2 — CID 166983599
(2Z,4E)-4-[[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methoxy]hepta-2,4,6-trien-1-ol (PubChem CID 166983599) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (2Z,4E)-4-[[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methoxy]hepta-2,4,6-trien-1-ol.
| Compound Name | (2Z,4E)-4-[[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methoxy]hepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 166983599 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (2Z,4E)-4-[[(3aR,6aS)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]methoxy]hepta-2,4,6-trien-1-ol |
| SMILES | C=C/C=C(\C=C/CO)OCN1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C15H23NO2/c1-2-5-15(8-4-9-17)18-12-16-10-13-6-3-7-14(13)11-16/h2,4-5,8,13-14,17H,1,3,6-7,9-12H2/b8-4-,15-5+/t13-,14+ |
| InChIKey | KVCVCPQLNYLKNX-QOUXBPBVSA-N |
| XLogP | 2.31 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|