C20H30N2 — CID 166983676
(2E,4E)-N-[(4,4-dimethyl-2,6-dimethylidenecyclohexylidene)methyl]-4-ethyl-1-methyliminohexa-2,4-dien-2-amine (PubChem CID 166983676) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is (2E,4E)-N-[(4,4-dimethyl-2,6-dimethylidenecyclohexylidene)methyl]-4-ethyl-1-methyliminohexa-2,4-dien-2-amine.
| Compound Name | (2E,4E)-N-[(4,4-dimethyl-2,6-dimethylidenecyclohexylidene)methyl]-4-ethyl-1-methyliminohexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 166983676 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | (2E,4E)-N-[(4,4-dimethyl-2,6-dimethylidenecyclohexylidene)methyl]-4-ethyl-1-methyliminohexa-2,4-dien-2-amine |
| SMILES | C=C1CC(C)(C)CC(=C)C1=CNC(/C=N/C)=C/C(=C/C)CC |
| InChI | InChI=1S/C20H30N2/c1-8-17(9-2)10-18(13-21-7)22-14-19-15(3)11-20(5,6)12-16(19)4/h8,10,13-14,22H,3-4,9,11-12H2,1-2,5-7H3/b17-8+,18-10+,21-13+ |
| InChIKey | WJCCFFZNGRWKBY-VNORPOISSA-N |
| XLogP | 5.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|