About 8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine
8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine (PubChem CID 166983729) has the molecular formula C11H14FN3
and a molecular weight of 207.25 g/mol. Its IUPAC name is 8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine |
| PubChem CID | 166983729 |
| Molecular Formula | C11H14FN3 |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine |
| SMILES | CCCNc1ccc2c(n1)=C(F)CCN=2 |
| InChI | InChI=1S/C11H14FN3/c1-2-6-14-10-4-3-9-11(15-10)8(12)5-7-13-9/h3-4H,2,5-7H2,1H3,(H,14,15) |
| InChIKey | QAJHGZGGSWOKOA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine?
The IUPAC name of 8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine (CID 166983729) is 8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine.
What is the SMILES notation for 8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine?
The canonical SMILES for 8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine is CCCNc1ccc2c(n1)=C(F)CCN=2.
What is the InChIKey of 8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine?
The InChIKey is QAJHGZGGSWOKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FN3/c1-2-6-14-10-4-3-9-11(15-10)8(12)5-7-13-9/h3-4H,2,5-7H2,1H3,(H,14,15).
What are the key properties of 8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine?
8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine has a molecular weight of 207.25 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-N-propyl-6,7-dihydro-1,5-naphthyridin-2-amine is sourced from PubChem (CID 166983729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).