C13H20N2 — CID 166983874
(2Z,5Z)-4-N-ethenyl-1-N-methyl-3-propan-2-ylhepta-2,5-diene-1,4-diimine (PubChem CID 166983874) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (2Z,5Z)-4-N-ethenyl-1-N-methyl-3-propan-2-ylhepta-2,5-diene-1,4-diimine.
| Compound Name | (2Z,5Z)-4-N-ethenyl-1-N-methyl-3-propan-2-ylhepta-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 166983874 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (2Z,5Z)-4-N-ethenyl-1-N-methyl-3-propan-2-ylhepta-2,5-diene-1,4-diimine |
| SMILES | C=C/N=C(\C=C/C)C(=C\C=N\C)/C(C)C |
| InChI | InChI=1S/C13H20N2/c1-6-8-13(15-7-2)12(11(3)4)9-10-14-5/h6-11H,2H2,1,3-5H3/b8-6-,12-9-,14-10+,15-13+ |
| InChIKey | BYOASVNTJXWKRT-FSSGZIADSA-N |
| XLogP | 3.43 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|