About [4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane
[4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane (PubChem CID 166984179) has the molecular formula C14H24S
and a molecular weight of 224.41 g/mol. Its IUPAC name is [4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane.
Molecular Properties
| Compound Name | [4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane |
| PubChem CID | 166984179 |
| Molecular Formula | C14H24S |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | [4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane |
| SMILES | CC(C)(C)Cc1ccc(S(C)(C)C)cc1 |
| InChI | InChI=1S/C14H24S/c1-14(2,3)11-12-7-9-13(10-8-12)15(4,5)6/h7-10H,11H2,1-6H3 |
| InChIKey | RIRDINRLLSBPMH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze [4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane?
The IUPAC name of [4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane (CID 166984179) is [4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane.
What is the SMILES notation for [4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane?
The canonical SMILES for [4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane is CC(C)(C)Cc1ccc(S(C)(C)C)cc1.
What is the InChIKey of [4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane?
The InChIKey is RIRDINRLLSBPMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24S/c1-14(2,3)11-12-7-9-13(10-8-12)15(4,5)6/h7-10H,11H2,1-6H3.
What are the key properties of [4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane?
[4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane has a molecular weight of 224.41 g/mol, XLogP of 4.33, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2,2-dimethylpropyl)phenyl]-trimethyl-λ4-sulfane is sourced from PubChem (CID 166984179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).