C10H17NO — CID 166984316
8-(ethoxymethyl)-1,2,3,5-tetrahydropyrrolizine (PubChem CID 166984316) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 8-(ethoxymethyl)-1,2,3,5-tetrahydropyrrolizine.
| Compound Name | 8-(ethoxymethyl)-1,2,3,5-tetrahydropyrrolizine |
|---|---|
| PubChem CID | 166984316 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 8-(ethoxymethyl)-1,2,3,5-tetrahydropyrrolizine |
| SMILES | CCOCC12C=CCN1CCC2 |
| InChI | InChI=1S/C10H17NO/c1-2-12-9-10-5-3-7-11(10)8-4-6-10/h3,5H,2,4,6-9H2,1H3 |
| InChIKey | JGQPCPJZDPSGBT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|