C27H35N3 — CID 166984446
2-hexa-1,5-dien-3-yl-4-[(1E)-3-[(1E)-hexa-1,5-dienyl]-5,6-dimethylidenedeca-1,9-dienyl]-1,3,5-triazine (PubChem CID 166984446) has the molecular formula C27H35N3 and a molecular weight of 401.60 g/mol. Its IUPAC name is 2-hexa-1,5-dien-3-yl-4-[(1E)-3-[(1E)-hexa-1,5-dienyl]-5,6-dimethylidenedeca-1,9-dienyl]-1,3,5-triazine.
| Compound Name | 2-hexa-1,5-dien-3-yl-4-[(1E)-3-[(1E)-hexa-1,5-dienyl]-5,6-dimethylidenedeca-1,9-dienyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166984446 |
| Molecular Formula | C27H35N3 |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | 2-hexa-1,5-dien-3-yl-4-[(1E)-3-[(1E)-hexa-1,5-dienyl]-5,6-dimethylidenedeca-1,9-dienyl]-1,3,5-triazine |
| SMILES | C=CCC/C=C/C(/C=C/c1ncnc(C(C=C)CC=C)n1)CC(=C)C(=C)CCC=C |
| InChI | InChI=1S/C27H35N3/c1-7-11-13-14-17-24(20-23(6)22(5)16-12-8-2)18-19-26-28-21-29-27(30-26)25(10-4)15-9-3/h7-10,14,17-19,21,24-25H,1-6,11-13,15-16,20H2/b17-14+,19-18+ |
| InChIKey | LFFRKTQKBPYRNX-LBEIZDTPSA-N |
| XLogP | 7.34 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|