C27H33N3 — CID 166984458
2-cyclohexa-2,4-dien-1-yl-4-[(1E)-3-cyclohexa-1,5-dien-1-yl-6-methyl-5-methylidenedeca-1,9-dienyl]-1,3,5-triazine (PubChem CID 166984458) has the molecular formula C27H33N3 and a molecular weight of 399.58 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-4-[(1E)-3-cyclohexa-1,5-dien-1-yl-6-methyl-5-methylidenedeca-1,9-dienyl]-1,3,5-triazine.
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-4-[(1E)-3-cyclohexa-1,5-dien-1-yl-6-methyl-5-methylidenedeca-1,9-dienyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166984458 |
| Molecular Formula | C27H33N3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-4-[(1E)-3-cyclohexa-1,5-dien-1-yl-6-methyl-5-methylidenedeca-1,9-dienyl]-1,3,5-triazine |
| SMILES | C=CCCC(C)C(=C)CC(/C=C/c1ncnc(C2C=CC=CC2)n1)C1=CCCC=C1 |
| InChI | InChI=1S/C27H33N3/c1-4-5-12-21(2)22(3)19-25(23-13-8-6-9-14-23)17-18-26-28-20-29-27(30-26)24-15-10-7-11-16-24/h4,7-8,10-11,13-15,17-18,20-21,24-25H,1,3,5-6,9,12,16,19H2,2H3/b18-17+ |
| InChIKey | ZZTFOMJYSCPGMV-ISLYRVAYSA-N |
| XLogP | 6.93 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|