C19H14ClN5O — CID 166984841
1-[(4-chlorophenyl)methyl]-N-pyrimidin-5-ylindazole-3-carboxamide (PubChem CID 166984841) has the molecular formula C19H14ClN5O and a molecular weight of 363.81 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-pyrimidin-5-ylindazole-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-pyrimidin-5-ylindazole-3-carboxamide |
|---|---|
| PubChem CID | 166984841 |
| Molecular Formula | C19H14ClN5O |
| Molecular Weight | 363.81 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-pyrimidin-5-ylindazole-3-carboxamide |
| SMILES | O=C(Nc1cncnc1)c1nn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C19H14ClN5O/c20-14-7-5-13(6-8-14)11-25-17-4-2-1-3-16(17)18(24-25)19(26)23-15-9-21-12-22-10-15/h1-10,12H,11H2,(H,23,26) |
| InChIKey | TXDPVQCUMWIZFN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.81 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |