C45H60N4O2 — CID 166985209
N-[(3R)-1-[[3-[2-[(1-methylazetidin-3-yl)amino]-2-oxoethyl]-5-phenyl-1-adamantyl]methyl]piperidin-3-yl]-3-phenyladamantane-1-carboxamide (PubChem CID 166985209) has the molecular formula C45H60N4O2 and a molecular weight of 689.00 g/mol. Its IUPAC name is N-[(3R)-1-[[3-[2-[(1-methylazetidin-3-yl)amino]-2-oxoethyl]-5-phenyl-1-adamantyl]methyl]piperidin-3-yl]-3-phenyladamantane-1-carboxamide.
| Compound Name | N-[(3R)-1-[[3-[2-[(1-methylazetidin-3-yl)amino]-2-oxoethyl]-5-phenyl-1-adamantyl]methyl]piperidin-3-yl]-3-phenyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 166985209 |
| Molecular Formula | C45H60N4O2 |
| Molecular Weight | 689.00 g/mol |
| Exact Mass | 688.47 |
| IUPAC Name | N-[(3R)-1-[[3-[2-[(1-methylazetidin-3-yl)amino]-2-oxoethyl]-5-phenyl-1-adamantyl]methyl]piperidin-3-yl]-3-phenyladamantane-1-carboxamide |
| SMILES | CN1CC(NC(=O)CC23CC4CC(CN5CCC[C@@H](NC(=O)C67CC8CC(C6)CC(c6ccccc6)(C8)C7)C5)(C2)CC(c2ccccc2)(C4)C3)C1 |
| InChI | InChI=1S/C45H60N4O2/c1-48-24-38(25-48)46-39(50)23-41-16-34-17-42(27-41,29-45(22-34,28-41)36-11-6-3-7-12-36)31-49-14-8-13-37(26-49)47-40(51)44-20-32-15-33(21-44)19-43(18-32,30-44)35-9-4-2-5-10-35/h2-7,9-12,32-34,37-38H,8,13-31H2,1H3,(H,46,50)(H,47,51)/t32?,33?,34?,37-,41?,42?,43?,44?,45?/m1/s1 |
| InChIKey | ZQZWBLMGVZQMBW-KINZVRJHSA-N |
| XLogP | 6.83 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.00 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |