C16H29N — CID 166985462
(4Z,6Z)-N-tert-butyl-N,2,6-trimethyl-3-methylideneocta-4,6-dien-2-amine (PubChem CID 166985462) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (4Z,6Z)-N-tert-butyl-N,2,6-trimethyl-3-methylideneocta-4,6-dien-2-amine.
| Compound Name | (4Z,6Z)-N-tert-butyl-N,2,6-trimethyl-3-methylideneocta-4,6-dien-2-amine |
|---|---|
| PubChem CID | 166985462 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (4Z,6Z)-N-tert-butyl-N,2,6-trimethyl-3-methylideneocta-4,6-dien-2-amine |
| SMILES | C=C(/C=C\C(C)=C/C)C(C)(C)N(C)C(C)(C)C |
| InChI | InChI=1S/C16H29N/c1-10-13(2)11-12-14(3)16(7,8)17(9)15(4,5)6/h10-12H,3H2,1-2,4-9H3/b12-11-,13-10- |
| InChIKey | CAAHJXNLCMCTEO-RBPRBBOISA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|