C38H56N5O13P — CID 166985656
[2-[[1,7-dioxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]carbamoyl]phenoxy]phosphonamidic acid (PubChem CID 166985656) has the molecular formula C38H56N5O13P and a molecular weight of 821.86 g/mol. Its IUPAC name is [2-[[1,7-dioxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]carbamoyl]phenoxy]phosphonamidic acid.
| Compound Name | [2-[[1,7-dioxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]carbamoyl]phenoxy]phosphonamidic acid |
|---|---|
| PubChem CID | 166985656 |
| Molecular Formula | C38H56N5O13P |
| Molecular Weight | 821.86 g/mol |
| Exact Mass | 821.36 |
| IUPAC Name | [2-[[1,7-dioxo-4-[3-oxo-3-[2-(2-prop-2-ynoxyethoxy)ethylamino]propyl]-1,7-bis[2-(2-prop-2-ynoxyethoxy)ethylamino]heptan-4-yl]carbamoyl]phenoxy]phosphonamidic acid |
| SMILES | C#CCOCCOCCNC(=O)CCC(CCC(=O)NCCOCCOCC#C)(CCC(=O)NCCOCCOCC#C)NC(=O)c1ccccc1OP(N)(=O)O |
| InChI | InChI=1S/C38H56N5O13P/c1-4-20-50-26-29-53-23-17-40-34(44)11-14-38(15-12-35(45)41-18-24-54-30-27-51-21-5-2,16-13-36(46)42-19-25-55-31-28-52-22-6-3)43-37(47)32-9-7-8-10-33(32)56-57(39,48)49/h1-3,7-10H,11-31H2,(H,40,44)(H,41,45)(H,42,46)(H,43,47)(H3,39,48,49) |
| InChIKey | QZFZVNLONWSBOM-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 244.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.86 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|