About 2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine
2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine (PubChem CID 166986186) has the molecular formula C11H27N3
and a molecular weight of 201.36 g/mol. Its IUPAC name is 2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine.
Molecular Properties
| Compound Name | 2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine |
| PubChem CID | 166986186 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | 2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine |
| SMILES | CCN(C)CN(C)C(C)(C)N(C)CC |
| InChI | InChI=1S/C11H27N3/c1-8-12(5)10-14(7)11(3,4)13(6)9-2/h8-10H2,1-7H3 |
| InChIKey | ISBOLEXIXLAPQF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine?
The IUPAC name of 2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine (CID 166986186) is 2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine.
What is the SMILES notation for 2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine?
The canonical SMILES for 2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine is CCN(C)CN(C)C(C)(C)N(C)CC.
What is the InChIKey of 2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine?
The InChIKey is ISBOLEXIXLAPQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27N3/c1-8-12(5)10-14(7)11(3,4)13(6)9-2/h8-10H2,1-7H3.
What are the key properties of 2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine?
2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine has a molecular weight of 201.36 g/mol, XLogP of 1.52, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-ethyl-2-N'-[[ethyl(methyl)amino]methyl]-2-N,2-N'-dimethylpropane-2,2-diamine is sourced from PubChem (CID 166986186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).