C10H14N2O6 — CID 166986658
N-hydroxy-2-[[1-hydroxy-2-(3,4,5-trihydroxyphenyl)ethyl]amino]acetamide (PubChem CID 166986658) has the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. Its IUPAC name is N-hydroxy-2-[[1-hydroxy-2-(3,4,5-trihydroxyphenyl)ethyl]amino]acetamide.
| Compound Name | N-hydroxy-2-[[1-hydroxy-2-(3,4,5-trihydroxyphenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 166986658 |
| Molecular Formula | C10H14N2O6 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | N-hydroxy-2-[[1-hydroxy-2-(3,4,5-trihydroxyphenyl)ethyl]amino]acetamide |
| SMILES | O=C(CNC(O)Cc1cc(O)c(O)c(O)c1)NO |
| InChI | InChI=1S/C10H14N2O6/c13-6-1-5(2-7(14)10(6)17)3-8(15)11-4-9(16)12-18/h1-2,8,11,13-15,17-18H,3-4H2,(H,12,16) |
| InChIKey | ARTZCBQLMVWQGJ-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|