C23H30N2O4 — CID 166986910
1,4-dioxan-2-ylmethyl (2Z)-2-[6-(2-cyclopropylethyl)-2-formyl-3,4-dihydroisoquinolin-1-ylidene]-N-methylethanimidate (PubChem CID 166986910) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 1,4-dioxan-2-ylmethyl (2Z)-2-[6-(2-cyclopropylethyl)-2-formyl-3,4-dihydroisoquinolin-1-ylidene]-N-methylethanimidate.
| Compound Name | 1,4-dioxan-2-ylmethyl (2Z)-2-[6-(2-cyclopropylethyl)-2-formyl-3,4-dihydroisoquinolin-1-ylidene]-N-methylethanimidate |
|---|---|
| PubChem CID | 166986910 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1,4-dioxan-2-ylmethyl (2Z)-2-[6-(2-cyclopropylethyl)-2-formyl-3,4-dihydroisoquinolin-1-ylidene]-N-methylethanimidate |
| SMILES | C/N=C(/C=C1/c2ccc(CCC3CC3)cc2CCN1C=O)OCC1COCCO1 |
| InChI | InChI=1S/C23H30N2O4/c1-24-23(29-15-20-14-27-10-11-28-20)13-22-21-7-6-18(5-4-17-2-3-17)12-19(21)8-9-25(22)16-26/h6-7,12-13,16-17,20H,2-5,8-11,14-15H2,1H3/b22-13-,24-23- |
| InChIKey | HCWFHLCGAZXONB-OQCIYUAISA-N |
| XLogP | 2.84 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|