C26H36O4 — CID 166987432
[13-(3,3-dimethylbutanoyloxy)-12-tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-trienyl] 3,3-dimethylbutanoate (PubChem CID 166987432) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is [13-(3,3-dimethylbutanoyloxy)-12-tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-trienyl] 3,3-dimethylbutanoate.
| Compound Name | [13-(3,3-dimethylbutanoyloxy)-12-tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-trienyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 166987432 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | [13-(3,3-dimethylbutanoyloxy)-12-tetracyclo[9.2.1.02,10.03,8]tetradeca-3,5,7-trienyl] 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)OC1C2CC(C1OC(=O)CC(C)(C)C)C1c3ccccc3CC21 |
| InChI | InChI=1S/C26H36O4/c1-25(2,3)13-20(27)29-23-18-12-19(24(23)30-21(28)14-26(4,5)6)22-16-10-8-7-9-15(16)11-17(18)22/h7-10,17-19,22-24H,11-14H2,1-6H3 |
| InChIKey | XUSRSOUQBPNNQQ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |