C17H18F2N6O — CID 166987661
2-(2,6-difluorophenyl)-4-(2-piperidin-4-ylhydrazinyl)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 166987661) has the molecular formula C17H18F2N6O and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-(2-piperidin-4-ylhydrazinyl)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 2-(2,6-difluorophenyl)-4-(2-piperidin-4-ylhydrazinyl)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 166987661 |
| Molecular Formula | C17H18F2N6O |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-(2-piperidin-4-ylhydrazinyl)-6,7-dihydropyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | O=C1NCc2nc(-c3c(F)cccc3F)nc(NNC3CCNCC3)c21 |
| InChI | InChI=1S/C17H18F2N6O/c18-10-2-1-3-11(19)13(10)15-22-12-8-21-17(26)14(12)16(23-15)25-24-9-4-6-20-7-5-9/h1-3,9,20,24H,4-8H2,(H,21,26)(H,22,23,25) |
| InChIKey | TYXKWVCUOAYQRQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|