About N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide
N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide (PubChem CID 166987883) has the molecular formula C9H19N3
and a molecular weight of 169.27 g/mol. Its IUPAC name is N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide |
| PubChem CID | 166987883 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide |
| SMILES | C=C(CCCN(C)C)N/C=N/C |
| InChI | InChI=1S/C9H19N3/c1-9(11-8-10-2)6-5-7-12(3)4/h8H,1,5-7H2,2-4H3,(H,10,11) |
| InChIKey | CNRFBODJBJRZRE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide?
The IUPAC name of N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide (CID 166987883) is N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide.
What is the SMILES notation for N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide?
The canonical SMILES for N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide is C=C(CCCN(C)C)N/C=N/C.
What is the InChIKey of N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide?
The InChIKey is CNRFBODJBJRZRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3/c1-9(11-8-10-2)6-5-7-12(3)4/h8H,1,5-7H2,2-4H3,(H,10,11).
What are the key properties of N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide?
N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide has a molecular weight of 169.27 g/mol, XLogP of 1.09, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(dimethylamino)pent-1-en-2-yl]-N'-methylmethanimidamide is sourced from PubChem (CID 166987883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).