C10H13NS — CID 166988007
2,5,6-trimethyl-3a,4-dihydro-1,3-benzothiazole (PubChem CID 166988007) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is 2,5,6-trimethyl-3a,4-dihydro-1,3-benzothiazole.
| Compound Name | 2,5,6-trimethyl-3a,4-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 166988007 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2,5,6-trimethyl-3a,4-dihydro-1,3-benzothiazole |
| SMILES | CC1=NC2CC(C)=C(C)C=C2S1 |
| InChI | InChI=1S/C10H13NS/c1-6-4-9-10(5-7(6)2)12-8(3)11-9/h5,9H,4H2,1-3H3 |
| InChIKey | IFCAAMSZBQUSAD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |