C45H89NO2 — CID 166988060
7-[4-(dipropylamino)butyl]-1-[(3E,12Z)-henicosa-3,12-dien-4-yl]oxytetradecan-7-ol (PubChem CID 166988060) has the molecular formula C45H89NO2 and a molecular weight of 676.21 g/mol. Its IUPAC name is 7-[4-(dipropylamino)butyl]-1-[(3E,12Z)-henicosa-3,12-dien-4-yl]oxytetradecan-7-ol.
| Compound Name | 7-[4-(dipropylamino)butyl]-1-[(3E,12Z)-henicosa-3,12-dien-4-yl]oxytetradecan-7-ol |
|---|---|
| PubChem CID | 166988060 |
| Molecular Formula | C45H89NO2 |
| Molecular Weight | 676.21 g/mol |
| Exact Mass | 675.69 |
| IUPAC Name | 7-[4-(dipropylamino)butyl]-1-[(3E,12Z)-henicosa-3,12-dien-4-yl]oxytetradecan-7-ol |
| SMILES | CC/C=C(\CCCCCCC/C=C\CCCCCCCC)OCCCCCCC(O)(CCCCCCC)CCCCN(CCC)CCC |
| InChI | InChI=1S/C45H89NO2/c1-6-11-13-15-16-17-18-19-20-21-22-23-24-25-29-36-44(35-8-3)48-43-34-28-27-31-38-45(47,37-30-26-14-12-7-2)39-32-33-42-46(40-9-4)41-10-5/h19-20,35,47H,6-18,21-34,36-43H2,1-5H3/b20-19-,44-35+ |
| InChIKey | DNYOHXKKVIUMMQ-SJWSEOOOSA-N |
| XLogP | 14.67 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.21 |
| LogP ≤ 5 | 14.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|