About 3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one
3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one (PubChem CID 166989109) has the molecular formula C8H6F3NO
and a molecular weight of 189.14 g/mol. Its IUPAC name is 3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one.
Molecular Properties
| Compound Name | 3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one |
| PubChem CID | 166989109 |
| Molecular Formula | C8H6F3NO |
| Molecular Weight | 189.14 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one |
| SMILES | O=C1CCc2[nH]cc(C(F)(F)F)c21 |
| InChI | InChI=1S/C8H6F3NO/c9-8(10,11)4-3-12-5-1-2-6(13)7(4)5/h3,12H,1-2H2 |
| InChIKey | MWBUXWWNNZGXNJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one?
The IUPAC name of 3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one (CID 166989109) is 3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one.
What is the SMILES notation for 3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one?
The canonical SMILES for 3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one is O=C1CCc2[nH]cc(C(F)(F)F)c21.
What is the InChIKey of 3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one?
The InChIKey is MWBUXWWNNZGXNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3NO/c9-8(10,11)4-3-12-5-1-2-6(13)7(4)5/h3,12H,1-2H2.
What are the key properties of 3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one?
3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one has a molecular weight of 189.14 g/mol, XLogP of 2.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(trifluoromethyl)-5,6-dihydro-1H-cyclopenta[b]pyrrol-4-one is sourced from PubChem (CID 166989109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).