About (3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol
(3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol (PubChem CID 166990345) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is (3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol.
Molecular Properties
| Compound Name | (3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol |
| PubChem CID | 166990345 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | (3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol |
| SMILES | Cc1nc2[nH]cc(C)c2nc1CO |
| InChI | InChI=1S/C9H11N3O/c1-5-3-10-9-8(5)12-7(4-13)6(2)11-9/h3,13H,4H2,1-2H3,(H,10,11) |
| InChIKey | NVKDSTXFPHMLCA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol?
The IUPAC name of (3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol (CID 166990345) is (3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol.
What is the SMILES notation for (3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol?
The canonical SMILES for (3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol is Cc1nc2[nH]cc(C)c2nc1CO.
What is the InChIKey of (3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol?
The InChIKey is NVKDSTXFPHMLCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-5-3-10-9-8(5)12-7(4-13)6(2)11-9/h3,13H,4H2,1-2H3,(H,10,11).
What are the key properties of (3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol?
(3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol has a molecular weight of 177.21 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,7-dimethyl-5H-pyrrolo[2,3-b]pyrazin-2-yl)methanol is sourced from PubChem (CID 166990345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).