C8H9N3S — CID 166990355
4,7-dimethyl-[1,3]thiazolo[4,5-c]pyridin-6-amine (PubChem CID 166990355) has the molecular formula C8H9N3S and a molecular weight of 179.25 g/mol. Its IUPAC name is 4,7-dimethyl-[1,3]thiazolo[4,5-c]pyridin-6-amine.
| Compound Name | 4,7-dimethyl-[1,3]thiazolo[4,5-c]pyridin-6-amine |
|---|---|
| PubChem CID | 166990355 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 4,7-dimethyl-[1,3]thiazolo[4,5-c]pyridin-6-amine |
| SMILES | Cc1nc(N)c(C)c2scnc12 |
| InChI | InChI=1S/C8H9N3S/c1-4-7-6(10-3-12-7)5(2)11-8(4)9/h3H,1-2H3,(H2,9,11) |
| InChIKey | LHQYLUBVFIYXMU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |