C19H37N3O3 — CID 166990378
(2R,3S)-3-amino-N-(2-methoxyethyl)-2-[(4-propan-2-ylcyclohexyl)oxymethyl]piperidine-1-carboxamide (PubChem CID 166990378) has the molecular formula C19H37N3O3 and a molecular weight of 355.52 g/mol. Its IUPAC name is (2R,3S)-3-amino-N-(2-methoxyethyl)-2-[(4-propan-2-ylcyclohexyl)oxymethyl]piperidine-1-carboxamide.
| Compound Name | (2R,3S)-3-amino-N-(2-methoxyethyl)-2-[(4-propan-2-ylcyclohexyl)oxymethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 166990378 |
| Molecular Formula | C19H37N3O3 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.28 |
| IUPAC Name | (2R,3S)-3-amino-N-(2-methoxyethyl)-2-[(4-propan-2-ylcyclohexyl)oxymethyl]piperidine-1-carboxamide |
| SMILES | COCCNC(=O)N1CCC[C@H](N)[C@@H]1COC1CCC(C(C)C)CC1 |
| InChI | InChI=1S/C19H37N3O3/c1-14(2)15-6-8-16(9-7-15)25-13-18-17(20)5-4-11-22(18)19(23)21-10-12-24-3/h14-18H,4-13,20H2,1-3H3,(H,21,23)/t15?,16?,17-,18-/m0/s1 |
| InChIKey | YUCVNUQBOUVRMY-FOIPXRHGSA-N |
| XLogP | 2.37 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|