C28H37F5N4O — CID 166991102
(6R)-6-[(3aS,4E,7aR)-7a-methyl-4-[2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol (PubChem CID 166991102) has the molecular formula C28H37F5N4O and a molecular weight of 540.62 g/mol. Its IUPAC name is (6R)-6-[(3aS,4E,7aR)-7a-methyl-4-[2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(3aS,4E,7aR)-7a-methyl-4-[2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 166991102 |
| Molecular Formula | C28H37F5N4O |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | (6R)-6-[(3aS,4E,7aR)-7a-methyl-4-[2-[5-[4-(trifluoromethyl)phenyl]tetrazol-2-yl]ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol |
| SMILES | C[C@H](CCC(F)(F)C(C)(C)O)C1CC[C@H]2/C(=C/Cn3nnc(-c4ccc(C(F)(F)F)cc4)n3)CCC[C@]12C |
| InChI | InChI=1S/C28H37F5N4O/c1-18(13-16-27(29,30)25(2,3)38)22-11-12-23-19(6-5-15-26(22,23)4)14-17-37-35-24(34-36-37)20-7-9-21(10-8-20)28(31,32)33/h7-10,14,18,22-23,38H,5-6,11-13,15-17H2,1-4H3/b19-14+/t18-,22?,23+,26-/m1/s1 |
| InChIKey | RIAIAWUOXHTKNU-NOOZECANSA-N |
| XLogP | 7.32 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|