C16H24FN — CID 166991113
(3Z,5Z)-3-butan-2-yl-6-ethyl-4-fluoro-2,2-dimethylocta-3,5,7-trienenitrile (PubChem CID 166991113) has the molecular formula C16H24FN and a molecular weight of 249.37 g/mol. Its IUPAC name is (3Z,5Z)-3-butan-2-yl-6-ethyl-4-fluoro-2,2-dimethylocta-3,5,7-trienenitrile.
| Compound Name | (3Z,5Z)-3-butan-2-yl-6-ethyl-4-fluoro-2,2-dimethylocta-3,5,7-trienenitrile |
|---|---|
| PubChem CID | 166991113 |
| Molecular Formula | C16H24FN |
| Molecular Weight | 249.37 g/mol |
| Exact Mass | 249.19 |
| IUPAC Name | (3Z,5Z)-3-butan-2-yl-6-ethyl-4-fluoro-2,2-dimethylocta-3,5,7-trienenitrile |
| SMILES | C=C/C(=C\C(F)=C(/C(C)CC)C(C)(C)C#N)CC |
| InChI | InChI=1S/C16H24FN/c1-7-12(4)15(16(5,6)11-18)14(17)10-13(8-2)9-3/h8,10,12H,2,7,9H2,1,3-6H3/b13-10+,15-14- |
| InChIKey | MJCBJAMVNREHJI-XLDKJKIHSA-N |
| XLogP | 5.33 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|