About (6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine
(6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine (PubChem CID 166991122) has the molecular formula C9H12FN
and a molecular weight of 153.20 g/mol. Its IUPAC name is (6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine.
Molecular Properties
| Compound Name | (6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine |
| PubChem CID | 166991122 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | (6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine |
| SMILES | C/C1=N/C=C(F)\C=C/CCC1 |
| InChI | InChI=1S/C9H12FN/c1-8-5-3-2-4-6-9(10)7-11-8/h4,6-7H,2-3,5H2,1H3/b6-4-,9-7+,11-8- |
| InChIKey | LMVYFPAFKDPMQJ-BGLYYDFRSA-N |
| XLogP | 3.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine?
The IUPAC name of (6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine (CID 166991122) is (6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine.
What is the SMILES notation for (6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine?
The canonical SMILES for (6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine is C/C1=N/C=C(F)\C=C/CCC1.
What is the InChIKey of (6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine?
The InChIKey is LMVYFPAFKDPMQJ-BGLYYDFRSA-N. The full InChI is InChI=1S/C9H12FN/c1-8-5-3-2-4-6-9(10)7-11-8/h4,6-7H,2-3,5H2,1H3/b6-4-,9-7+,11-8-.
What are the key properties of (6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine?
(6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine has a molecular weight of 153.20 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z,8E)-8-fluoro-2-methyl-4,5-dihydro-3H-azonine is sourced from PubChem (CID 166991122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).