C21H12F7NO3S — CID 166991320
6-(2,3,5,6-tetrafluorophenyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 166991320) has the molecular formula C21H12F7NO3S and a molecular weight of 491.38 g/mol. Its IUPAC name is 6-(2,3,5,6-tetrafluorophenyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 6-(2,3,5,6-tetrafluorophenyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 166991320 |
| Molecular Formula | C21H12F7NO3S |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | 6-(2,3,5,6-tetrafluorophenyl)-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | O=S(=O)(c1cccc(C(F)(F)F)c1)N1CCOc2ccc(-c3c(F)c(F)cc(F)c3F)cc21 |
| InChI | InChI=1S/C21H12F7NO3S/c22-14-10-15(23)20(25)18(19(14)24)11-4-5-17-16(8-11)29(6-7-32-17)33(30,31)13-3-1-2-12(9-13)21(26,27)28/h1-5,8-10H,6-7H2 |
| InChIKey | GWTWTSPLCCAJEJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|