About 7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline
7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline (PubChem CID 166991688) has the molecular formula C23H21F2NS
and a molecular weight of 381.49 g/mol. Its IUPAC name is 7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 166991688 |
| Molecular Formula | C23H21F2NS |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline |
| SMILES | Cc1cccc(SN2CC(C)Cc3ccc(-c4cc(F)ccc4F)cc32)c1 |
| InChI | InChI=1S/C23H21F2NS/c1-15-4-3-5-20(11-15)27-26-14-16(2)10-18-7-6-17(12-23(18)26)21-13-19(24)8-9-22(21)25/h3-9,11-13,16H,10,14H2,1-2H3 |
| InChIKey | DBEMFTMWQNKCLT-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline?
The IUPAC name of 7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline (CID 166991688) is 7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for 7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline is Cc1cccc(SN2CC(C)Cc3ccc(-c4cc(F)ccc4F)cc32)c1.
What is the InChIKey of 7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline?
The InChIKey is DBEMFTMWQNKCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F2NS/c1-15-4-3-5-20(11-15)27-26-14-16(2)10-18-7-6-17(12-23(18)26)21-13-19(24)8-9-22(21)25/h3-9,11-13,16H,10,14H2,1-2H3.
What are the key properties of 7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline?
7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline has a molecular weight of 381.49 g/mol, XLogP of 6.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,5-difluorophenyl)-3-methyl-1-(3-methylphenyl)sulfanyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 166991688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).