C12H21BrN2 — CID 166992242
(2Z,4E)-4,8-dimethyl-9-(methylamino)nona-2,4-dienimidoyl bromide (PubChem CID 166992242) has the molecular formula C12H21BrN2 and a molecular weight of 273.22 g/mol. Its IUPAC name is (2Z,4E)-4,8-dimethyl-9-(methylamino)nona-2,4-dienimidoyl bromide.
| Compound Name | (2Z,4E)-4,8-dimethyl-9-(methylamino)nona-2,4-dienimidoyl bromide |
|---|---|
| PubChem CID | 166992242 |
| Molecular Formula | C12H21BrN2 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (2Z,4E)-4,8-dimethyl-9-(methylamino)nona-2,4-dienimidoyl bromide |
| SMILES | [H]/N=C(Br)/C=C\C(C)=C\CCC(C)CNC |
| InChI | InChI=1S/C12H21BrN2/c1-10(7-8-12(13)14)5-4-6-11(2)9-15-3/h5,7-8,11,14-15H,4,6,9H2,1-3H3/b8-7-,10-5+,14-12- |
| InChIKey | WQRLWANAJVMYFA-OBMRLOGQSA-N |
| XLogP | 3.50 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|