About (Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide
(Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide (PubChem CID 166992371) has the molecular formula C7H9BrN4
and a molecular weight of 229.08 g/mol. Its IUPAC name is (Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide |
| PubChem CID | 166992371 |
| Molecular Formula | C7H9BrN4 |
| Molecular Weight | 229.08 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | (Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide |
| SMILES | C/C=C\C(N)=N\C(C#N)=C(/N)Br |
| InChI | InChI=1S/C7H9BrN4/c1-2-3-6(10)12-5(4-9)7(8)11/h2-3H,11H2,1H3,(H2,10,12)/b3-2-,7-5- |
| InChIKey | JLZSPWFOPFBQAM-ZSBGFAJOSA-N |
| XLogP | 0.97 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.08 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide?
The IUPAC name of (Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide (CID 166992371) is (Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide.
What is the SMILES notation for (Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide?
The canonical SMILES for (Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide is C/C=C\C(N)=N\C(C#N)=C(/N)Br.
What is the InChIKey of (Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide?
The InChIKey is JLZSPWFOPFBQAM-ZSBGFAJOSA-N. The full InChI is InChI=1S/C7H9BrN4/c1-2-3-6(10)12-5(4-9)7(8)11/h2-3H,11H2,1H3,(H2,10,12)/b3-2-,7-5-.
What are the key properties of (Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide?
(Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide has a molecular weight of 229.08 g/mol, XLogP of 0.97, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-[(E)-2-amino-2-bromo-1-cyanoethenyl]but-2-enimidamide is sourced from PubChem (CID 166992371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).