About N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine
N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine (PubChem CID 166992725) has the molecular formula C14H25NS
and a molecular weight of 239.43 g/mol. Its IUPAC name is N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine |
| PubChem CID | 166992725 |
| Molecular Formula | C14H25NS |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine |
| SMILES | CNC(SC(C)C(C)C)C1=CC(C)CC=C1 |
| InChI | InChI=1S/C14H25NS/c1-10(2)12(4)16-14(15-5)13-8-6-7-11(3)9-13/h6,8-12,14-15H,7H2,1-5H3 |
| InChIKey | FMXSBSXODJRGLM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine?
The IUPAC name of N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine (CID 166992725) is N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine.
What is the SMILES notation for N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine?
The canonical SMILES for N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine is CNC(SC(C)C(C)C)C1=CC(C)CC=C1.
What is the InChIKey of N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine?
The InChIKey is FMXSBSXODJRGLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NS/c1-10(2)12(4)16-14(15-5)13-8-6-7-11(3)9-13/h6,8-12,14-15H,7H2,1-5H3.
What are the key properties of N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine?
N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine has a molecular weight of 239.43 g/mol, XLogP of 3.83, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(3-methylbutan-2-ylsulfanyl)-1-(3-methylcyclohexa-1,5-dien-1-yl)methanamine is sourced from PubChem (CID 166992725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).