C24H18F2N4O — CID 166992732
6-(3-amino-2-carbamimidoylphenyl)-N-(3,5-difluorophenyl)naphthalene-1-carboxamide (PubChem CID 166992732) has the molecular formula C24H18F2N4O and a molecular weight of 416.43 g/mol. Its IUPAC name is 6-(3-amino-2-carbamimidoylphenyl)-N-(3,5-difluorophenyl)naphthalene-1-carboxamide.
| Compound Name | 6-(3-amino-2-carbamimidoylphenyl)-N-(3,5-difluorophenyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 166992732 |
| Molecular Formula | C24H18F2N4O |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 6-(3-amino-2-carbamimidoylphenyl)-N-(3,5-difluorophenyl)naphthalene-1-carboxamide |
| SMILES | [H]/N=C(\N)c1c(N)cccc1-c1ccc2c(C(=O)Nc3cc(F)cc(F)c3)cccc2c1 |
| InChI | InChI=1S/C24H18F2N4O/c25-15-10-16(26)12-17(11-15)30-24(31)20-5-1-3-13-9-14(7-8-18(13)20)19-4-2-6-21(27)22(19)23(28)29/h1-12H,27H2,(H3,28,29)(H,30,31) |
| InChIKey | FZBGMFZYUCDBEH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|