About cyclohexa-1,3-dien-1-yl 4-fluorobenzoate
cyclohexa-1,3-dien-1-yl 4-fluorobenzoate (PubChem CID 166992748) has the molecular formula C13H11FO2
and a molecular weight of 218.23 g/mol. Its IUPAC name is cyclohexa-1,3-dien-1-yl 4-fluorobenzoate.
Molecular Properties
| Compound Name | cyclohexa-1,3-dien-1-yl 4-fluorobenzoate |
| PubChem CID | 166992748 |
| Molecular Formula | C13H11FO2 |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | cyclohexa-1,3-dien-1-yl 4-fluorobenzoate |
| SMILES | O=C(OC1=CC=CCC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H11FO2/c14-11-8-6-10(7-9-11)13(15)16-12-4-2-1-3-5-12/h1-2,4,6-9H,3,5H2 |
| InChIKey | UIPPUKGZLOYABN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexa-1,3-dien-1-yl 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-1,3-dien-1-yl 4-fluorobenzoate?
The IUPAC name of cyclohexa-1,3-dien-1-yl 4-fluorobenzoate (CID 166992748) is cyclohexa-1,3-dien-1-yl 4-fluorobenzoate.
What is the SMILES notation for cyclohexa-1,3-dien-1-yl 4-fluorobenzoate?
The canonical SMILES for cyclohexa-1,3-dien-1-yl 4-fluorobenzoate is O=C(OC1=CC=CCC1)c1ccc(F)cc1.
What is the InChIKey of cyclohexa-1,3-dien-1-yl 4-fluorobenzoate?
The InChIKey is UIPPUKGZLOYABN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11FO2/c14-11-8-6-10(7-9-11)13(15)16-12-4-2-1-3-5-12/h1-2,4,6-9H,3,5H2.
What are the key properties of cyclohexa-1,3-dien-1-yl 4-fluorobenzoate?
cyclohexa-1,3-dien-1-yl 4-fluorobenzoate has a molecular weight of 218.23 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-1,3-dien-1-yl 4-fluorobenzoate is sourced from PubChem (CID 166992748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).