About [4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate
[4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate (PubChem CID 166992969) has the molecular formula C31H40O5
and a molecular weight of 492.66 g/mol. Its IUPAC name is [4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate.
Molecular Properties
| Compound Name | [4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate |
| PubChem CID | 166992969 |
| Molecular Formula | C31H40O5 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | [4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)Oc1ccc(C2=Cc3ccc(OC(=O)C(CCC)CCC)cc3OC2)cc1 |
| InChI | InChI=1S/C31H40O5/c1-5-9-23(10-6-2)30(32)35-27-16-13-22(14-17-27)26-19-25-15-18-28(20-29(25)34-21-26)36-31(33)24(11-7-3)12-8-4/h13-20,23-24H,5-12,21H2,1-4H3 |
| InChIKey | HMJAXQYOPCYPMT-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate?
The IUPAC name of [4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate (CID 166992969) is [4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate.
What is the SMILES notation for [4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate?
The canonical SMILES for [4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate is CCCC(CCC)C(=O)Oc1ccc(C2=Cc3ccc(OC(=O)C(CCC)CCC)cc3OC2)cc1.
What is the InChIKey of [4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate?
The InChIKey is HMJAXQYOPCYPMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H40O5/c1-5-9-23(10-6-2)30(32)35-27-16-13-22(14-17-27)26-19-25-15-18-28(20-29(25)34-21-26)36-31(33)24(11-7-3)12-8-4/h13-20,23-24H,5-12,21H2,1-4H3.
What are the key properties of [4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate?
[4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate has a molecular weight of 492.66 g/mol, XLogP of 7.86, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[7-(2-propylpentanoyloxy)-2H-chromen-3-yl]phenyl] 2-propylpentanoate is sourced from PubChem (CID 166992969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).