About (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide
(E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide (PubChem CID 166993001) has the molecular formula C14H22N2O4
and a molecular weight of 282.34 g/mol. Its IUPAC name is (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide.
Molecular Properties
| Compound Name | (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide |
| PubChem CID | 166993001 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide |
| SMILES | CC/C=C(\CC)C(=O)N(C(C)O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H22N2O4/c1-4-6-10(5-2)14(20)16(9(3)17)11-7-8-12(18)15-13(11)19/h6,9,11,17H,4-5,7-8H2,1-3H3,(H,15,18,19)/b10-6+ |
| InChIKey | UCUYPRJEEUUYHB-UXBLZVDNSA-N |
| XLogP | 0.70 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide?
The IUPAC name of (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide (CID 166993001) is (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide.
What is the SMILES notation for (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide?
The canonical SMILES for (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide is CC/C=C(\CC)C(=O)N(C(C)O)C1CCC(=O)NC1=O.
What is the InChIKey of (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide?
The InChIKey is UCUYPRJEEUUYHB-UXBLZVDNSA-N. The full InChI is InChI=1S/C14H22N2O4/c1-4-6-10(5-2)14(20)16(9(3)17)11-7-8-12(18)15-13(11)19/h6,9,11,17H,4-5,7-8H2,1-3H3,(H,15,18,19)/b10-6+.
What are the key properties of (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide?
(E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide has a molecular weight of 282.34 g/mol, XLogP of 0.70, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(2,6-dioxopiperidin-3-yl)-2-ethyl-N-(1-hydroxyethyl)pent-2-enamide is sourced from PubChem (CID 166993001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).