About 2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine
2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 166993755) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine |
| PubChem CID | 166993755 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | C/N=C/C(=CN)N(C)c1ccccc1NC |
| InChI | InChI=1S/C12H18N4/c1-14-9-10(8-13)16(3)12-7-5-4-6-11(12)15-2/h4-9,15H,13H2,1-3H3/b10-8?,14-9+ |
| InChIKey | QVHQVGBMZZPVMV-ISUDJSGRSA-N |
| XLogP | 1.67 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine?
The IUPAC name of 2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine (CID 166993755) is 2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine.
What is the SMILES notation for 2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine?
The canonical SMILES for 2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine is C/N=C/C(=CN)N(C)c1ccccc1NC.
What is the InChIKey of 2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine?
The InChIKey is QVHQVGBMZZPVMV-ISUDJSGRSA-N. The full InChI is InChI=1S/C12H18N4/c1-14-9-10(8-13)16(3)12-7-5-4-6-11(12)15-2/h4-9,15H,13H2,1-3H3/b10-8?,14-9+.
What are the key properties of 2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine?
2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine has a molecular weight of 218.30 g/mol, XLogP of 1.67, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(1-amino-3-methyliminoprop-1-en-2-yl)-1-N,2-N-dimethylbenzene-1,2-diamine is sourced from PubChem (CID 166993755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).