About 3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde
3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 166994450) has the molecular formula C8H9FO2
and a molecular weight of 156.16 g/mol. Its IUPAC name is 3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 166994450 |
| Molecular Formula | C8H9FO2 |
| Molecular Weight | 156.16 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | O=CC1=CC(F)=CCC1CO |
| InChI | InChI=1S/C8H9FO2/c9-8-2-1-6(4-10)7(3-8)5-11/h2-3,5-6,10H,1,4H2 |
| InChIKey | SWLPIQUUSXSIDN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.16 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde (CID 166994450) is 3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde is O=CC1=CC(F)=CCC1CO.
What is the InChIKey of 3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is SWLPIQUUSXSIDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FO2/c9-8-2-1-6(4-10)7(3-8)5-11/h2-3,5-6,10H,1,4H2.
What are the key properties of 3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde?
3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 156.16 g/mol, XLogP of 0.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-6-(hydroxymethyl)cyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 166994450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).