C16H18N2 — CID 166995229
(4E,5E)-4-ethylidene-2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-5-prop-2-enylidene-1H-imidazole (PubChem CID 166995229) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (4E,5E)-4-ethylidene-2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-5-prop-2-enylidene-1H-imidazole.
| Compound Name | (4E,5E)-4-ethylidene-2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-5-prop-2-enylidene-1H-imidazole |
|---|---|
| PubChem CID | 166995229 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | (4E,5E)-4-ethylidene-2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-5-prop-2-enylidene-1H-imidazole |
| SMILES | C=C/C=C\C(=C/C=C)c1nc(=C/C)/c(=C\C=C)[nH]1 |
| InChI | InChI=1S/C16H18N2/c1-5-9-12-13(10-6-2)16-17-14(8-4)15(18-16)11-7-3/h5-12H,1-3H2,4H3,(H,17,18)/b12-9-,13-10+,14-8+,15-11+ |
| InChIKey | KKIKKCREIXHGCY-AHNJRKNPSA-N |
| XLogP | 2.49 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|